C42H39N3O6 — CID 56965843
(1S,4R,6S,9R,11S,14R)-2,7,12-tris[(4-methoxyphenyl)methyl]-2,7,12-triazaheptacyclo[12.6.1.04,19.06,18.09,17.011,16.015,20]henicosa-15,17,19-triene-3,8,13-trione (PubChem CID 56965843) has the molecular formula C42H39N3O6 and a molecular weight of 681.79 g/mol. Its IUPAC name is (1S,4R,6S,9R,11S,14R)-2,7,12-tris[(4-methoxyphenyl)methyl]-2,7,12-triazaheptacyclo[12.6.1.04,19.06,18.09,17.011,16.015,20]henicosa-15,17,19-triene-3,8,13-trione.
| Compound Name | (1S,4R,6S,9R,11S,14R)-2,7,12-tris[(4-methoxyphenyl)methyl]-2,7,12-triazaheptacyclo[12.6.1.04,19.06,18.09,17.011,16.015,20]henicosa-15,17,19-triene-3,8,13-trione |
|---|---|
| PubChem CID | 56965843 |
| Molecular Formula | C42H39N3O6 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | (1S,4R,6S,9R,11S,14R)-2,7,12-tris[(4-methoxyphenyl)methyl]-2,7,12-triazaheptacyclo[12.6.1.04,19.06,18.09,17.011,16.015,20]henicosa-15,17,19-triene-3,8,13-trione |
| SMILES | COc1ccc(CN2C(=O)[C@@H]3C[C@H]4c5c3c3c6c7c5[C@@H](C[C@@H]7N(Cc5ccc(OC)cc5)C(=O)[C@@H]6C[C@@H]32)C(=O)N4Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H39N3O6/c1-49-25-10-4-22(5-11-25)19-43-31-16-29-35-37(31)34-28(40(43)46)17-32-38(34)36-30(42(48)44(32)20-23-6-12-26(50-2)13-7-23)18-33(39(35)36)45(41(29)47)21-24-8-14-27(51-3)15-9-24/h4-15,28-33H,16-21H2,1-3H3/t28-,29-,30-,31+,32+,33+/m1/s1 |
| InChIKey | JBIJYOLLSZKSPV-OKYIMTKNSA-N |
| XLogP | 6.42 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |