C27H35N3O3 — CID 92656066
(1R)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 92656066) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is (1R)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | (1R)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 92656066 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (1R)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3[C@@H]2C(=O)NCCCN2C[C@H](C)C[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C27H35N3O3/c1-19-15-20(2)17-29(16-19)14-6-13-28-26(31)25-23-7-4-5-8-24(23)27(32)30(25)18-21-9-11-22(33-3)12-10-21/h4-5,7-12,19-20,25H,6,13-18H2,1-3H3,(H,28,31)/t19-,20-,25-/m1/s1 |
| InChIKey | IOCWLLOYZJKDJP-UMEGOILYSA-N |
| XLogP | 3.88 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|