C18H25NO4 — CID 143641585
ethane;methyl (2R)-1-[(4-methoxyphenyl)methyl]-7-oxo-3,6-dihydro-2H-azepine-2-carboxylate (PubChem CID 143641585) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethane;methyl (2R)-1-[(4-methoxyphenyl)methyl]-7-oxo-3,6-dihydro-2H-azepine-2-carboxylate.
| Compound Name | ethane;methyl (2R)-1-[(4-methoxyphenyl)methyl]-7-oxo-3,6-dihydro-2H-azepine-2-carboxylate |
|---|---|
| PubChem CID | 143641585 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethane;methyl (2R)-1-[(4-methoxyphenyl)methyl]-7-oxo-3,6-dihydro-2H-azepine-2-carboxylate |
| SMILES | CC.COC(=O)[C@H]1CC=CCC(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H19NO4.C2H6/c1-20-13-9-7-12(8-10-13)11-17-14(16(19)21-2)5-3-4-6-15(17)18;1-2/h3-4,7-10,14H,5-6,11H2,1-2H3;1-2H3/t14-;/m1./s1 |
| InChIKey | CEGPEQLECLZZHJ-PFEQFJNWSA-N |
| XLogP | 2.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|