C23H18ClFN2O4 — CID 171545159
7-amino-1-(2-chloro-5-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-5-carboxylic acid (PubChem CID 171545159) has the molecular formula C23H18ClFN2O4 and a molecular weight of 440.86 g/mol. Its IUPAC name is 7-amino-1-(2-chloro-5-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-5-carboxylic acid.
| Compound Name | 7-amino-1-(2-chloro-5-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 171545159 |
| Molecular Formula | C23H18ClFN2O4 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 7-amino-1-(2-chloro-5-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-5-carboxylic acid |
| SMILES | COc1ccc(CN2C(=O)c3cc(C(=O)O)cc(N)c3C2c2cc(F)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H18ClFN2O4/c1-31-15-5-2-12(3-6-15)11-27-21(16-10-14(25)4-7-18(16)24)20-17(22(27)28)8-13(23(29)30)9-19(20)26/h2-10,21H,11,26H2,1H3,(H,29,30) |
| InChIKey | VMTXNFHDLRXEHI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|