C23H15BrClFN4O3 — CID 176899978
6-bromo-7-(2-chloro-5-fluorophenyl)-8-[(4-methoxyphenyl)methyl]-3,7-dihydropyrrolo[3,4-h][1,2,3]benzotriazine-4,9-dione (PubChem CID 176899978) has the molecular formula C23H15BrClFN4O3 and a molecular weight of 529.75 g/mol. Its IUPAC name is 6-bromo-7-(2-chloro-5-fluorophenyl)-8-[(4-methoxyphenyl)methyl]-3,7-dihydropyrrolo[3,4-h][1,2,3]benzotriazine-4,9-dione.
| Compound Name | 6-bromo-7-(2-chloro-5-fluorophenyl)-8-[(4-methoxyphenyl)methyl]-3,7-dihydropyrrolo[3,4-h][1,2,3]benzotriazine-4,9-dione |
|---|---|
| PubChem CID | 176899978 |
| Molecular Formula | C23H15BrClFN4O3 |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | 6-bromo-7-(2-chloro-5-fluorophenyl)-8-[(4-methoxyphenyl)methyl]-3,7-dihydropyrrolo[3,4-h][1,2,3]benzotriazine-4,9-dione |
| SMILES | COc1ccc(CN2C(=O)c3c(c(Br)cc4c(=O)[nH]nnc34)C2c2cc(F)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H15BrClFN4O3/c1-33-13-5-2-11(3-6-13)10-30-21(14-8-12(26)4-7-17(14)25)18-16(24)9-15-20(19(18)23(30)32)27-29-28-22(15)31/h2-9,21H,10H2,1H3,(H,27,28,31) |
| InChIKey | HYMYZLAGXHVWIC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |