C29H29NO10 — CID 11049928
[(13R,14S,18R,19S)-9-acetyloxy-12-[(4-methoxyphenyl)methyl]-16,16-dimethyl-11-oxo-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(20),2,4(8),9-tetraen-19-yl] acetate (PubChem CID 11049928) has the molecular formula C29H29NO10 and a molecular weight of 551.55 g/mol. Its IUPAC name is [(13R,14S,18R,19S)-9-acetyloxy-12-[(4-methoxyphenyl)methyl]-16,16-dimethyl-11-oxo-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(20),2,4(8),9-tetraen-19-yl] acetate.
| Compound Name | [(13R,14S,18R,19S)-9-acetyloxy-12-[(4-methoxyphenyl)methyl]-16,16-dimethyl-11-oxo-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(20),2,4(8),9-tetraen-19-yl] acetate |
|---|---|
| PubChem CID | 11049928 |
| Molecular Formula | C29H29NO10 |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | [(13R,14S,18R,19S)-9-acetyloxy-12-[(4-methoxyphenyl)methyl]-16,16-dimethyl-11-oxo-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(20),2,4(8),9-tetraen-19-yl] acetate |
| SMILES | COc1ccc(CN2C(=O)c3c(cc4c(c3OC(C)=O)OCO4)C3=C[C@H](OC(C)=O)[C@H]4OC(C)(C)O[C@H]4[C@@H]32)cc1 |
| InChI | InChI=1S/C29H29NO10/c1-14(31)37-21-11-19-18-10-20-24(36-13-35-20)26(38-15(2)32)22(18)28(33)30(12-16-6-8-17(34-5)9-7-16)23(19)27-25(21)39-29(3,4)40-27/h6-11,21,23,25,27H,12-13H2,1-5H3/t21-,23+,25+,27-/m0/s1 |
| InChIKey | NNJQAWSGLWGEQT-BBVYRSAVSA-N |
| XLogP | 3.22 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|