C22H21NO11 — CID 164831475
[(2S,3R,4S)-3,4,7-triacetyloxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate (PubChem CID 164831475) has the molecular formula C22H21NO11 and a molecular weight of 475.41 g/mol. Its IUPAC name is [(2S,3R,4S)-3,4,7-triacetyloxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate.
| Compound Name | [(2S,3R,4S)-3,4,7-triacetyloxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 164831475 |
| Molecular Formula | C22H21NO11 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | [(2S,3R,4S)-3,4,7-triacetyloxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate |
| SMILES | CC(=O)Oc1c2c(cc3c1C(=O)NC1C3=C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O)OCO2 |
| InChI | InChI=1S/C22H21NO11/c1-8(24)31-15-6-13-12-5-14-18(30-7-29-14)20(33-10(3)26)16(12)22(28)23-17(13)21(34-11(4)27)19(15)32-9(2)25/h5-6,15,17,19,21H,7H2,1-4H3,(H,23,28)/t15-,17?,19+,21-/m0/s1 |
| InChIKey | LFSZASRPEMYAPR-ZCMMIIOJSA-N |
| XLogP | 0.64 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|