C24H25NO13 — CID 15086290
[(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetraacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate (PubChem CID 15086290) has the molecular formula C24H25NO13 and a molecular weight of 535.46 g/mol. Its IUPAC name is [(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetraacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate.
| Compound Name | [(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetraacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate |
|---|---|
| PubChem CID | 15086290 |
| Molecular Formula | C24H25NO13 |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | [(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetraacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate |
| SMILES | CC(=O)Oc1c2c(cc3c1C(=O)N[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]31)OCO2 |
| InChI | InChI=1S/C24H25NO13/c1-8(26)34-19-15-13-6-14-18(33-7-32-14)20(35-9(2)27)16(13)24(31)25-17(15)21(36-10(3)28)23(38-12(5)30)22(19)37-11(4)29/h6,15,17,19,21-23H,7H2,1-5H3,(H,25,31)/t15-,17-,19-,21+,22+,23+/m1/s1 |
| InChIKey | SPXOTRLMKUQBJC-BAPTUPQKSA-N |
| XLogP | 0.28 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|