C22H32NO10P — CID 54588345
[(2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-7-yl] dibutyl phosphate (PubChem CID 54588345) has the molecular formula C22H32NO10P and a molecular weight of 501.47 g/mol. Its IUPAC name is [(2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-7-yl] dibutyl phosphate.
| Compound Name | [(2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-7-yl] dibutyl phosphate |
|---|---|
| PubChem CID | 54588345 |
| Molecular Formula | C22H32NO10P |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [(2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-7-yl] dibutyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)Oc1c2c(cc3c1C(=O)N[C@H]1[C@H](O)[C@H](O)[C@@H](O)C[C@H]31)OCO2 |
| InChI | InChI=1S/C22H32NO10P/c1-3-5-7-31-34(28,32-8-6-4-2)33-21-16-12(10-15-20(21)30-11-29-15)13-9-14(24)18(25)19(26)17(13)23-22(16)27/h10,13-14,17-19,24-26H,3-9,11H2,1-2H3,(H,23,27)/t13-,14+,17-,18-,19+/m1/s1 |
| InChIKey | MPBXTAPWTBTFFZ-CTMNZFAUSA-N |
| XLogP | 2.22 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|