C14H13NO9P- — CID 23250372
(1R,13R,14S,18R,19S)-9,19-dihydroxy-16-oxido-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one (PubChem CID 23250372) has the molecular formula C14H13NO9P- and a molecular weight of 370.23 g/mol. Its IUPAC name is (1R,13R,14S,18R,19S)-9,19-dihydroxy-16-oxido-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one.
| Compound Name | (1R,13R,14S,18R,19S)-9,19-dihydroxy-16-oxido-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one |
|---|---|
| PubChem CID | 23250372 |
| Molecular Formula | C14H13NO9P- |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (1R,13R,14S,18R,19S)-9,19-dihydroxy-16-oxido-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one |
| SMILES | O=C1N[C@H]2[C@@H]3OP(=O)([O-])O[C@@H]3[C@@H](O)C[C@@H]2c2cc3c(c(O)c21)OCO3 |
| InChI | InChI=1S/C14H14NO9P/c16-6-1-5-4-2-7-12(22-3-21-7)10(17)8(4)14(18)15-9(5)13-11(6)23-25(19,20)24-13/h2,5-6,9,11,13,16-17H,1,3H2,(H,15,18)(H,19,20)/p-1/t5-,6+,9-,11-,13+/m1/s1 |
| InChIKey | PRXQHOXUYJMARM-HRQCSNBYSA-M |
| XLogP | -0.67 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|