C21H23NO10 — CID 134822495
(3,4-diacetyloxy-7-hydroxy-6-oxo-2,3,4,4a,5,9,10,12b-octahydro-1H-[1,4]dioxino[2,3-j]phenanthridin-2-yl) acetate (PubChem CID 134822495) has the molecular formula C21H23NO10 and a molecular weight of 449.41 g/mol. Its IUPAC name is (3,4-diacetyloxy-7-hydroxy-6-oxo-2,3,4,4a,5,9,10,12b-octahydro-1H-[1,4]dioxino[2,3-j]phenanthridin-2-yl) acetate.
| Compound Name | (3,4-diacetyloxy-7-hydroxy-6-oxo-2,3,4,4a,5,9,10,12b-octahydro-1H-[1,4]dioxino[2,3-j]phenanthridin-2-yl) acetate |
|---|---|
| PubChem CID | 134822495 |
| Molecular Formula | C21H23NO10 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (3,4-diacetyloxy-7-hydroxy-6-oxo-2,3,4,4a,5,9,10,12b-octahydro-1H-[1,4]dioxino[2,3-j]phenanthridin-2-yl) acetate |
| SMILES | CC(=O)OC1CC2c3cc4c(c(O)c3C(=O)NC2C(OC(C)=O)C1OC(C)=O)OCCO4 |
| InChI | InChI=1S/C21H23NO10/c1-8(23)30-14-7-12-11-6-13-18(29-5-4-28-13)17(26)15(11)21(27)22-16(12)20(32-10(3)25)19(14)31-9(2)24/h6,12,14,16,19-20,26H,4-5,7H2,1-3H3,(H,22,27) |
| InChIKey | LULIDJBAPOZFSO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|