C28H27NO12 — CID 12039110
[(5aR,6S,7S,8S,9R,9aR)-6,7,8-triacetyloxy-11-methoxy-4-oxo-5a,6,7,8,9,9a-hexahydro-5H-[1,3]dioxolo[4,5-i]phenanthridin-9-yl] benzoate (PubChem CID 12039110) has the molecular formula C28H27NO12 and a molecular weight of 569.52 g/mol. Its IUPAC name is [(5aR,6S,7S,8S,9R,9aR)-6,7,8-triacetyloxy-11-methoxy-4-oxo-5a,6,7,8,9,9a-hexahydro-5H-[1,3]dioxolo[4,5-i]phenanthridin-9-yl] benzoate.
| Compound Name | [(5aR,6S,7S,8S,9R,9aR)-6,7,8-triacetyloxy-11-methoxy-4-oxo-5a,6,7,8,9,9a-hexahydro-5H-[1,3]dioxolo[4,5-i]phenanthridin-9-yl] benzoate |
|---|---|
| PubChem CID | 12039110 |
| Molecular Formula | C28H27NO12 |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | [(5aR,6S,7S,8S,9R,9aR)-6,7,8-triacetyloxy-11-methoxy-4-oxo-5a,6,7,8,9,9a-hexahydro-5H-[1,3]dioxolo[4,5-i]phenanthridin-9-yl] benzoate |
| SMILES | COc1cc2c(c3c1OCO3)C(=O)N[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C28H27NO12/c1-12(30)38-24-20-18(16-10-17(35-4)21-22(37-11-36-21)19(16)27(33)29-20)23(41-28(34)15-8-6-5-7-9-15)25(39-13(2)31)26(24)40-14(3)32/h5-10,18,20,23-26H,11H2,1-4H3,(H,29,33)/t18-,20-,23-,24+,25+,26+/m1/s1 |
| InChIKey | VPQNILICSDVJHR-QTHAFQERSA-N |
| XLogP | 1.65 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|