C29H30O10 — CID 74412908
(3,9,11-trihydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl) benzoate (PubChem CID 74412908) has the molecular formula C29H30O10 and a molecular weight of 538.55 g/mol. Its IUPAC name is (3,9,11-trihydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl) benzoate.
| Compound Name | (3,9,11-trihydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl) benzoate |
|---|---|
| PubChem CID | 74412908 |
| Molecular Formula | C29H30O10 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (3,9,11-trihydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl) benzoate |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc3c(c1OC)OCO3)C(O)C(C)C(C)(O)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H30O10/c1-14-22(30)16-11-19-25(38-13-37-19)26(36-5)21(16)20-17(12-18(34-3)24(35-4)23(20)31)27(29(14,2)33)39-28(32)15-9-7-6-8-10-15/h6-12,14,22,27,30-31,33H,13H2,1-5H3 |
| InChIKey | KPIZSPPLKVFPIO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |