C34H38O11 — CID 162963764
[3,9,16-trihydroxy-4,5,14,15-tetramethoxy-9,10-dimethyl-11-(2-methylbut-2-enoyloxy)-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate (PubChem CID 162963764) has the molecular formula C34H38O11 and a molecular weight of 622.67 g/mol. Its IUPAC name is [3,9,16-trihydroxy-4,5,14,15-tetramethoxy-9,10-dimethyl-11-(2-methylbut-2-enoyloxy)-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate.
| Compound Name | [3,9,16-trihydroxy-4,5,14,15-tetramethoxy-9,10-dimethyl-11-(2-methylbut-2-enoyloxy)-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate |
|---|---|
| PubChem CID | 162963764 |
| Molecular Formula | C34H38O11 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | [3,9,16-trihydroxy-4,5,14,15-tetramethoxy-9,10-dimethyl-11-(2-methylbut-2-enoyloxy)-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate |
| SMILES | CC=C(C)C(=O)OC1c2cc(OC)c(OC)c(O)c2-c2c(cc(OC)c(OC)c2O)C(OC(=O)c2ccccc2)C(C)(O)C1C |
| InChI | InChI=1S/C34H38O11/c1-9-17(2)32(37)44-28-18(3)34(4,39)31(45-33(38)19-13-11-10-12-14-19)21-16-23(41-6)30(43-8)27(36)25(21)24-20(28)15-22(40-5)29(42-7)26(24)35/h9-16,18,28,31,35-36,39H,1-8H3 |
| InChIKey | FGACFCPIJZFIEZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|