C31H34O10 — CID 162842820
(11-acetyloxy-3,14-dihydroxy-4,5,15,16-tetramethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) benzoate (PubChem CID 162842820) has the molecular formula C31H34O10 and a molecular weight of 566.60 g/mol. Its IUPAC name is (11-acetyloxy-3,14-dihydroxy-4,5,15,16-tetramethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) benzoate.
| Compound Name | (11-acetyloxy-3,14-dihydroxy-4,5,15,16-tetramethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) benzoate |
|---|---|
| PubChem CID | 162842820 |
| Molecular Formula | C31H34O10 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (11-acetyloxy-3,14-dihydroxy-4,5,15,16-tetramethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) benzoate |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc(O)c(OC)c1OC)C(OC(C)=O)C(C)C(C)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H34O10/c1-15-16(2)27(41-31(35)18-11-9-8-10-12-18)20-14-22(36-4)29(38-6)25(34)23(20)24-19(26(15)40-17(3)32)13-21(33)28(37-5)30(24)39-7/h8-16,26-27,33-34H,1-7H3 |
| InChIKey | VQERRHIMELCMLQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |