C34H38O11 — CID 74337028
(11-acetyloxy-3,9-dihydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 3-phenylprop-2-enoate (PubChem CID 74337028) has the molecular formula C34H38O11 and a molecular weight of 622.67 g/mol. Its IUPAC name is (11-acetyloxy-3,9-dihydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 3-phenylprop-2-enoate.
| Compound Name | (11-acetyloxy-3,9-dihydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 74337028 |
| Molecular Formula | C34H38O11 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | (11-acetyloxy-3,9-dihydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl) 3-phenylprop-2-enoate |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc(OC)c(OC)c1OC)C(OC(C)=O)C(C)C(C)(O)C2OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C34H38O11/c1-18-29(44-19(2)35)21-16-24(40-5)31(42-7)32(43-8)27(21)26-22(17-23(39-4)30(41-6)28(26)37)33(34(18,3)38)45-25(36)15-14-20-12-10-9-11-13-20/h9-18,29,33,37-38H,1-8H3 |
| InChIKey | HCRDYSMLGNXTDO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|