C31H32O8 — CID 162930136
[(9R,10R,11S)-3-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] 3-phenylprop-2-enoate (PubChem CID 162930136) has the molecular formula C31H32O8 and a molecular weight of 532.59 g/mol. Its IUPAC name is [(9R,10R,11S)-3-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] 3-phenylprop-2-enoate.
| Compound Name | [(9R,10R,11S)-3-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162930136 |
| Molecular Formula | C31H32O8 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | [(9R,10R,11S)-3-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] 3-phenylprop-2-enoate |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc3c(c1OC)OCO3)[C@@H](OC(=O)C=Cc1ccccc1)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C31H32O8/c1-17-13-20-14-22(34-3)29(35-4)27(33)25(20)26-21(15-23-30(31(26)36-5)38-16-37-23)28(18(17)2)39-24(32)12-11-19-9-7-6-8-10-19/h6-12,14-15,17-18,28,33H,13,16H2,1-5H3/t17-,18-,28+/m1/s1 |
| InChIKey | MWCNCFCBBXKOCI-AYEUKFJJSA-N |
| XLogP | 5.94 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|