C24H28O8 — CID 57333724
[(9R,10R,11S)-11-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-yl] acetate (PubChem CID 57333724) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(9R,10R,11S)-11-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-yl] acetate.
| Compound Name | [(9R,10R,11S)-11-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-yl] acetate |
|---|---|
| PubChem CID | 57333724 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [(9R,10R,11S)-11-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-yl] acetate |
| SMILES | COc1cc2c(c(OC(C)=O)c1OC)-c1c(cc3c(c1OC)OCO3)[C@@H](O)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C24H28O8/c1-11-7-14-8-16(27-4)21(28-5)24(32-13(3)25)18(14)19-15(20(26)12(11)2)9-17-22(23(19)29-6)31-10-30-17/h8-9,11-12,20,26H,7,10H2,1-6H3/t11-,12-,20+/m1/s1 |
| InChIKey | FMEQLOQKWWMQQN-HTGLOVNISA-N |
| XLogP | 3.90 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|