C22H26O5 — CID 102424837
(9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene (PubChem CID 102424837) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene.
| Compound Name | (9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene |
|---|---|
| PubChem CID | 102424837 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene |
| SMILES | COc1cc2c(cc1OC)-c1c(cc3c(c1OC)OCO3)C[C@@H](C)[C@@H](C)C2 |
| InChI | InChI=1S/C22H26O5/c1-12-6-14-8-17(23-3)18(24-4)10-16(14)20-15(7-13(12)2)9-19-21(22(20)25-5)27-11-26-19/h8-10,12-13H,6-7,11H2,1-5H3/t12-,13+/m0/s1 |
| InChIKey | VGSPEFXOOQOBBF-QWHCGFSZSA-N |
| XLogP | 4.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |