C24H24O10 — CID 134831926
dimethyl (12S,13S)-3,22-dimethoxy-5,7,18,20-tetraoxapentacyclo[13.7.0.02,10.04,8.017,21]docosa-1(22),2,4(8),9,15,17(21)-hexaene-12,13-dicarboxylate (PubChem CID 134831926) has the molecular formula C24H24O10 and a molecular weight of 472.45 g/mol. Its IUPAC name is dimethyl (12S,13S)-3,22-dimethoxy-5,7,18,20-tetraoxapentacyclo[13.7.0.02,10.04,8.017,21]docosa-1(22),2,4(8),9,15,17(21)-hexaene-12,13-dicarboxylate.
| Compound Name | dimethyl (12S,13S)-3,22-dimethoxy-5,7,18,20-tetraoxapentacyclo[13.7.0.02,10.04,8.017,21]docosa-1(22),2,4(8),9,15,17(21)-hexaene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 134831926 |
| Molecular Formula | C24H24O10 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | dimethyl (12S,13S)-3,22-dimethoxy-5,7,18,20-tetraoxapentacyclo[13.7.0.02,10.04,8.017,21]docosa-1(22),2,4(8),9,15,17(21)-hexaene-12,13-dicarboxylate |
| SMILES | COC(=O)[C@H]1Cc2cc3c(c(OC)c2-c2c(cc4c(c2OC)OCO4)C[C@@H]1C(=O)OC)OCO3 |
| InChI | InChI=1S/C24H24O10/c1-27-21-17-11(7-15-19(21)33-9-31-15)5-13(23(25)29-3)14(24(26)30-4)6-12-8-16-20(34-10-32-16)22(28-2)18(12)17/h7-8,13-14H,5-6,9-10H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | VUFOEBFAKYTXKQ-KBPBESRZSA-N |
| XLogP | 2.51 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |