C22H22O7 — CID 162986275
(1S,21S,24S)-9,12-dimethoxy-24-methyl-5,7,14,16,23-pentaoxahexacyclo[19.2.1.02,10.04,8.011,19.013,17]tetracosa-2,4(8),9,11,13(17),18-hexaene (PubChem CID 162986275) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is (1S,21S,24S)-9,12-dimethoxy-24-methyl-5,7,14,16,23-pentaoxahexacyclo[19.2.1.02,10.04,8.011,19.013,17]tetracosa-2,4(8),9,11,13(17),18-hexaene.
| Compound Name | (1S,21S,24S)-9,12-dimethoxy-24-methyl-5,7,14,16,23-pentaoxahexacyclo[19.2.1.02,10.04,8.011,19.013,17]tetracosa-2,4(8),9,11,13(17),18-hexaene |
|---|---|
| PubChem CID | 162986275 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (1S,21S,24S)-9,12-dimethoxy-24-methyl-5,7,14,16,23-pentaoxahexacyclo[19.2.1.02,10.04,8.011,19.013,17]tetracosa-2,4(8),9,11,13(17),18-hexaene |
| SMILES | COc1c2c(cc3c1-c1c(cc4c(c1OC)OCO4)[C@H]1OC[C@@H](C3)[C@@H]1C)OCO2 |
| InChI | InChI=1S/C22H22O7/c1-10-12-4-11-5-14-19(28-8-26-14)21(23-2)16(11)17-13(18(10)25-7-12)6-15-20(22(17)24-3)29-9-27-15/h5-6,10,12,18H,4,7-9H2,1-3H3/t10-,12+,18-/m0/s1 |
| InChIKey | ZXZUDTYLUHGDRO-NMOXLHADSA-N |
| XLogP | 3.71 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |