C23H28O7 — CID 162928828
(1R,15R,18S)-4,5,6,9,10-pentamethoxy-18-methyl-17-oxatetracyclo[13.2.1.02,7.08,13]octadeca-2,4,6,8,10,12-hexaen-11-ol (PubChem CID 162928828) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (1R,15R,18S)-4,5,6,9,10-pentamethoxy-18-methyl-17-oxatetracyclo[13.2.1.02,7.08,13]octadeca-2,4,6,8,10,12-hexaen-11-ol.
| Compound Name | (1R,15R,18S)-4,5,6,9,10-pentamethoxy-18-methyl-17-oxatetracyclo[13.2.1.02,7.08,13]octadeca-2,4,6,8,10,12-hexaen-11-ol |
|---|---|
| PubChem CID | 162928828 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (1R,15R,18S)-4,5,6,9,10-pentamethoxy-18-methyl-17-oxatetracyclo[13.2.1.02,7.08,13]octadeca-2,4,6,8,10,12-hexaen-11-ol |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(O)c(OC)c1OC)C[C@H]1CO[C@@H]2[C@H]1C |
| InChI | InChI=1S/C23H28O7/c1-11-13-7-12-8-15(24)20(26-3)22(28-5)17(12)18-14(19(11)30-10-13)9-16(25-2)21(27-4)23(18)29-6/h8-9,11,13,19,24H,7,10H2,1-6H3/t11-,13-,19+/m0/s1 |
| InChIKey | XJUOGJHZZOCIGO-MJLGCCKJSA-N |
| XLogP | 3.98 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |