C15H19N2O4+ — CID 6953663
N-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-enamide (PubChem CID 6953663) has the molecular formula C15H19N2O4+ and a molecular weight of 291.33 g/mol. Its IUPAC name is N-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-enamide.
| Compound Name | N-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6953663 |
| Molecular Formula | C15H19N2O4+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1c2c(cc3c(c2OC)OCO3)CC[NH+]1C |
| InChI | InChI=1S/C15H18N2O4/c1-4-11(18)16-15-12-9(5-6-17(15)2)7-10-13(14(12)19-3)21-8-20-10/h4,7,15H,1,5-6,8H2,2-3H3,(H,16,18)/p+1/t15-/m0/s1 |
| InChIKey | MWKSRXOYKOAOPZ-HNNXBMFYSA-O |
| XLogP | -0.20 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|