C16H21N2O4+ — CID 3697493
N-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)prop-2-enamide (PubChem CID 3697493) has the molecular formula C16H21N2O4+ and a molecular weight of 305.35 g/mol. Its IUPAC name is N-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)prop-2-enamide.
| Compound Name | N-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3697493 |
| Molecular Formula | C16H21N2O4+ |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1c2c(cc3c(c2OC)OCO3)CC[N+]1(C)C |
| InChI | InChI=1S/C16H20N2O4/c1-5-12(19)17-16-13-10(6-7-18(16,2)3)8-11-14(15(13)20-4)22-9-21-11/h5,8,16H,1,6-7,9H2,2-4H3/p+1 |
| InChIKey | INRINYQOYWOUJH-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|