C21H24INO5 — CID 71966068
4-(furan-2-yl)-1-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)but-3-en-2-one iodide (PubChem CID 71966068) has the molecular formula C21H24INO5 and a molecular weight of 497.33 g/mol. Its IUPAC name is 4-(furan-2-yl)-1-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)but-3-en-2-one iodide.
| Compound Name | 4-(furan-2-yl)-1-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)but-3-en-2-one iodide |
|---|---|
| PubChem CID | 71966068 |
| Molecular Formula | C21H24INO5 |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 4-(furan-2-yl)-1-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)but-3-en-2-one iodide |
| SMILES | COc1c2c(cc3c1C(CC(=O)C=Cc1ccco1)[N+](C)(C)CC3)OCO2.[I-] |
| InChI | InChI=1S/C21H24NO5.HI/c1-22(2)9-8-14-11-18-20(27-13-26-18)21(24-3)19(14)17(22)12-15(23)6-7-16-5-4-10-25-16;/h4-7,10-11,17H,8-9,12-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FLWYYMYNEOLMRZ-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|