C21H24INO5 — CID 163332549
5-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide (PubChem CID 163332549) has the molecular formula C21H24INO5 and a molecular weight of 497.33 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
|---|---|
| PubChem CID | 163332549 |
| Molecular Formula | C21H24INO5 |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
| SMILES | COc1c2c(cc3c1C(Cc1ccc4c(c1)OCO4)[N+](C)(C)CC3)OCO2.[I-] |
| InChI | InChI=1S/C21H24NO5.HI/c1-22(2)7-6-14-10-18-20(27-12-26-18)21(23-3)19(14)15(22)8-13-4-5-16-17(9-13)25-11-24-16;/h4-5,9-10,15H,6-8,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | YASKNOIFYKWXHE-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|