C21H25BrNO4+ — CID 3797944
1-(4-bromophenyl)-2-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)ethanol (PubChem CID 3797944) has the molecular formula C21H25BrNO4+ and a molecular weight of 435.34 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)ethanol.
| Compound Name | 1-(4-bromophenyl)-2-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)ethanol |
|---|---|
| PubChem CID | 3797944 |
| Molecular Formula | C21H25BrNO4+ |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1-(4-bromophenyl)-2-(4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl)ethanol |
| SMILES | COc1c2c(cc3c1C(CC(O)c1ccc(Br)cc1)[N+](C)(C)CC3)OCO2 |
| InChI | InChI=1S/C21H25BrNO4/c1-23(2)9-8-14-10-18-20(27-12-26-18)21(25-3)19(14)16(23)11-17(24)13-4-6-15(22)7-5-13/h4-7,10,16-17,24H,8-9,11-12H2,1-3H3/q+1 |
| InChIKey | MNEMBLITWSCIAC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|