C25H30NO5+ — CID 1403545
(E)-4-(4-ethoxyphenyl)-1-[(5R)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]but-3-en-2-one (PubChem CID 1403545) has the molecular formula C25H30NO5+ and a molecular weight of 424.52 g/mol. Its IUPAC name is (E)-4-(4-ethoxyphenyl)-1-[(5R)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]but-3-en-2-one.
| Compound Name | (E)-4-(4-ethoxyphenyl)-1-[(5R)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 1403545 |
| Molecular Formula | C25H30NO5+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (E)-4-(4-ethoxyphenyl)-1-[(5R)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]but-3-en-2-one |
| SMILES | CCOc1ccc(/C=C/C(=O)C[C@@H]2c3c(cc4c(c3OC)OCO4)CC[N+]2(C)C)cc1 |
| InChI | InChI=1S/C25H30NO5/c1-5-29-20-10-7-17(8-11-20)6-9-19(27)15-21-23-18(12-13-26(21,2)3)14-22-24(25(23)28-4)31-16-30-22/h6-11,14,21H,5,12-13,15-16H2,1-4H3/q+1/b9-6+/t21-/m1/s1 |
| InChIKey | KVABLDHEQSMFLE-VHTFYLNKSA-N |
| XLogP | 4.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|