C19H21N3O5S — CID 1426579
5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-3-prop-2-enyl-2-sulfanylidenepyrimidin-4-olate (PubChem CID 1426579) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-3-prop-2-enyl-2-sulfanylidenepyrimidin-4-olate.
| Compound Name | 5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-3-prop-2-enyl-2-sulfanylidenepyrimidin-4-olate |
|---|---|
| PubChem CID | 1426579 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-3-prop-2-enyl-2-sulfanylidenepyrimidin-4-olate |
| SMILES | C=CCn1c([O-])c([C@@H]2c3c(cc4c(c3OC)OCO4)CC[NH+]2C)c(=O)[nH]c1=S |
| InChI | InChI=1S/C19H21N3O5S/c1-4-6-22-18(24)13(17(23)20-19(22)28)14-12-10(5-7-21(14)2)8-11-15(16(12)25-3)27-9-26-11/h4,8,14,24H,1,5-7,9H2,2-3H3,(H,20,23,28)/t14-/m0/s1 |
| InChIKey | GAIAWCIKELXUFQ-AWEZNQCLSA-N |
| XLogP | 0.06 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|