C22H20ClN3O5S — CID 1426257
3-(2-chlorophenyl)-5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-2-sulfanylidenepyrimidin-4-olate (PubChem CID 1426257) has the molecular formula C22H20ClN3O5S and a molecular weight of 473.94 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-2-sulfanylidenepyrimidin-4-olate.
| Compound Name | 3-(2-chlorophenyl)-5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-2-sulfanylidenepyrimidin-4-olate |
|---|---|
| PubChem CID | 1426257 |
| Molecular Formula | C22H20ClN3O5S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 3-(2-chlorophenyl)-5-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6-oxo-2-sulfanylidenepyrimidin-4-olate |
| SMILES | COc1c2c(cc3c1[C@@H](c1c([O-])n(-c4ccccc4Cl)c(=S)[nH]c1=O)[NH+](C)CC3)OCO2 |
| InChI | InChI=1S/C22H20ClN3O5S/c1-25-8-7-11-9-14-18(31-10-30-14)19(29-2)15(11)17(25)16-20(27)24-22(32)26(21(16)28)13-6-4-3-5-12(13)23/h3-6,9,17,28H,7-8,10H2,1-2H3,(H,24,27,32)/t17-/m0/s1 |
| InChIKey | JNMNBIRAYXBFFA-KRWDZBQOSA-N |
| XLogP | 1.52 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|