C15H19F3NO4+ — CID 6953557
(2S)-1,1,1-trifluoro-3-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]propan-2-ol (PubChem CID 6953557) has the molecular formula C15H19F3NO4+ and a molecular weight of 334.31 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 6953557 |
| Molecular Formula | C15H19F3NO4+ |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]propan-2-ol |
| SMILES | COc1c2c(cc3c1[C@@H](C[C@H](O)C(F)(F)F)[NH+](C)CC3)OCO2 |
| InChI | InChI=1S/C15H18F3NO4/c1-19-4-3-8-5-10-13(23-7-22-10)14(21-2)12(8)9(19)6-11(20)15(16,17)18/h5,9,11,20H,3-4,6-7H2,1-2H3/p+1/t9-,11+/m1/s1 |
| InChIKey | UXFNZISLPDRVOR-KOLCDFICSA-O |
| XLogP | 0.85 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |