C22H30NO4+ — CID 7078870
(3S)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,7-dimethyloct-6-en-1-yn-3-ol (PubChem CID 7078870) has the molecular formula C22H30NO4+ and a molecular weight of 372.49 g/mol. Its IUPAC name is (3S)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,7-dimethyloct-6-en-1-yn-3-ol.
| Compound Name | (3S)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,7-dimethyloct-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 7078870 |
| Molecular Formula | C22H30NO4+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (3S)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,7-dimethyloct-6-en-1-yn-3-ol |
| SMILES | COc1c2c(cc3c1[C@@H](C#C[C@@](C)(O)CCC=C(C)C)[NH+](C)CC3)OCO2 |
| InChI | InChI=1S/C22H29NO4/c1-15(2)7-6-10-22(3,24)11-8-17-19-16(9-12-23(17)4)13-18-20(21(19)25-5)27-14-26-18/h7,13,17,24H,6,9-10,12,14H2,1-5H3/p+1/t17-,22+/m1/s1 |
| InChIKey | PUGTZMPAXSKRFM-VGSWGCGISA-O |
| XLogP | 2.04 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|