C20H28NO4+ — CID 906162
(3R)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,5-dimethylhex-1-yn-3-ol (PubChem CID 906162) has the molecular formula C20H28NO4+ and a molecular weight of 346.45 g/mol. Its IUPAC name is (3R)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,5-dimethylhex-1-yn-3-ol.
| Compound Name | (3R)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,5-dimethylhex-1-yn-3-ol |
|---|---|
| PubChem CID | 906162 |
| Molecular Formula | C20H28NO4+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3R)-1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3,5-dimethylhex-1-yn-3-ol |
| SMILES | COc1c2c(cc3c1[C@@H](C#C[C@](C)(O)CC(C)C)[NH+](C)CC3)OCO2 |
| InChI | InChI=1S/C20H27NO4/c1-13(2)11-20(3,22)8-6-15-17-14(7-9-21(15)4)10-16-18(19(17)23-5)25-12-24-16/h10,13,15,22H,7,9,11-12H2,1-5H3/p+1/t15-,20+/m1/s1 |
| InChIKey | WDWVQTOTLXZGON-QRWLVFNGSA-O |
| XLogP | 1.34 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|