C26H23NO10 — CID 24956563
[(2S,3R,4S,4aR)-2,3-diacetyloxy-7-hydroxy-6-oxo-1-phenyl-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl] acetate (PubChem CID 24956563) has the molecular formula C26H23NO10 and a molecular weight of 509.47 g/mol. Its IUPAC name is [(2S,3R,4S,4aR)-2,3-diacetyloxy-7-hydroxy-6-oxo-1-phenyl-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl] acetate.
| Compound Name | [(2S,3R,4S,4aR)-2,3-diacetyloxy-7-hydroxy-6-oxo-1-phenyl-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl] acetate |
|---|---|
| PubChem CID | 24956563 |
| Molecular Formula | C26H23NO10 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [(2S,3R,4S,4aR)-2,3-diacetyloxy-7-hydroxy-6-oxo-1-phenyl-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(c2ccccc2)=C2c3cc4c(c(O)c3C(=O)N[C@H]21)OCO4 |
| InChI | InChI=1S/C26H23NO10/c1-11(28)35-23-17(14-7-5-4-6-8-14)18-15-9-16-22(34-10-33-16)21(31)19(15)26(32)27-20(18)24(36-12(2)29)25(23)37-13(3)30/h4-9,20,23-25,31H,10H2,1-3H3,(H,27,32)/t20-,23+,24+,25-/m1/s1 |
| InChIKey | FPDYMGMVVZEIGW-AKAGGGOCSA-N |
| XLogP | 1.95 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|