C26H29NO12 — CID 143654989
ethyl 2-[(3R,4S,4aR)-3,4-diacetyloxy-7-(2-ethoxy-2-oxoethoxy)-6-oxo-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-5-yl]acetate (PubChem CID 143654989) has the molecular formula C26H29NO12 and a molecular weight of 547.51 g/mol. Its IUPAC name is ethyl 2-[(3R,4S,4aR)-3,4-diacetyloxy-7-(2-ethoxy-2-oxoethoxy)-6-oxo-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-5-yl]acetate.
| Compound Name | ethyl 2-[(3R,4S,4aR)-3,4-diacetyloxy-7-(2-ethoxy-2-oxoethoxy)-6-oxo-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-5-yl]acetate |
|---|---|
| PubChem CID | 143654989 |
| Molecular Formula | C26H29NO12 |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | ethyl 2-[(3R,4S,4aR)-3,4-diacetyloxy-7-(2-ethoxy-2-oxoethoxy)-6-oxo-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-5-yl]acetate |
| SMILES | CCOC(=O)COc1c2c(cc3c1C(=O)N(CC(=O)OCC)[C@@H]1C3=CC[C@@H](OC(C)=O)[C@H]1OC(C)=O)OCO2 |
| InChI | InChI=1S/C26H29NO12/c1-5-33-19(30)10-27-22-15(7-8-17(38-13(3)28)23(22)39-14(4)29)16-9-18-24(37-12-36-18)25(21(16)26(27)32)35-11-20(31)34-6-2/h7,9,17,22-23H,5-6,8,10-12H2,1-4H3/t17-,22-,23-/m1/s1 |
| InChIKey | SCNGSNUAKUDJMP-NLSFWIRASA-N |
| XLogP | 1.40 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|