C10H10O4 — CID 59796488
(6-methyl-1,3-benzodioxol-4-yl) acetate (PubChem CID 59796488) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (6-methyl-1,3-benzodioxol-4-yl) acetate.
| Compound Name | (6-methyl-1,3-benzodioxol-4-yl) acetate |
|---|---|
| PubChem CID | 59796488 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (6-methyl-1,3-benzodioxol-4-yl) acetate |
| SMILES | CC(=O)Oc1cc(C)cc2c1OCO2 |
| InChI | InChI=1S/C10H10O4/c1-6-3-8-10(13-5-12-8)9(4-6)14-7(2)11/h3-4H,5H2,1-2H3 |
| InChIKey | NFKPVVHYNOYMFE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|