C9H9NO3 — CID 134485450
(NE)-N-[(6-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine (PubChem CID 134485450) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is (NE)-N-[(6-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(6-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 134485450 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (NE)-N-[(6-methyl-1,3-benzodioxol-4-yl)methylidene]hydroxylamine |
| SMILES | Cc1cc(/C=N/O)c2c(c1)OCO2 |
| InChI | InChI=1S/C9H9NO3/c1-6-2-7(4-10-11)9-8(3-6)12-5-13-9/h2-4,11H,5H2,1H3/b10-4+ |
| InChIKey | UNFVWVAOHCVMTM-ONNFQVAWSA-N |
| XLogP | 1.53 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|