C13H15NO3Si — CID 11821383
(NE)-N-[[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]methylidene]hydroxylamine (PubChem CID 11821383) has the molecular formula C13H15NO3Si and a molecular weight of 261.35 g/mol. Its IUPAC name is (NE)-N-[[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 11821383 |
| Molecular Formula | C13H15NO3Si |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (NE)-N-[[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]methylidene]hydroxylamine |
| SMILES | C[Si](C)(C)C#Cc1cc2c(cc1/C=N/O)OCO2 |
| InChI | InChI=1S/C13H15NO3Si/c1-18(2,3)5-4-10-6-12-13(17-9-16-12)7-11(10)8-14-15/h6-8,15H,9H2,1-3H3/b14-8+ |
| InChIKey | QXORLXBINWSRSW-RIYZIHGNSA-N |
| XLogP | 2.45 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|