C10H8N4O2S — CID 122195834
[(E)-(6-cyano-1,3-benzodioxol-5-yl)methylideneamino]thiourea (PubChem CID 122195834) has the molecular formula C10H8N4O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is [(E)-(6-cyano-1,3-benzodioxol-5-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(6-cyano-1,3-benzodioxol-5-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 122195834 |
| Molecular Formula | C10H8N4O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | [(E)-(6-cyano-1,3-benzodioxol-5-yl)methylideneamino]thiourea |
| SMILES | N#Cc1cc2c(cc1/C=N/NC(N)=S)OCO2 |
| InChI | InChI=1S/C10H8N4O2S/c11-3-6-1-8-9(16-5-15-8)2-7(6)4-13-14-10(12)17/h1-2,4H,5H2,(H3,12,14,17)/b13-4+ |
| InChIKey | VFIUJEYQNYPLIS-YIXHJXPBSA-N |
| XLogP | 0.45 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|