C10H10N6O2 — CID 168603494
2-(6-cyano-1,3-benzodioxol-5-yl)-1-(diaminomethylidene)guanidine (PubChem CID 168603494) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-(6-cyano-1,3-benzodioxol-5-yl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(6-cyano-1,3-benzodioxol-5-yl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168603494 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(6-cyano-1,3-benzodioxol-5-yl)-1-(diaminomethylidene)guanidine |
| SMILES | N#Cc1cc2c(cc1/N=C(\N)N=C(N)N)OCO2 |
| InChI | InChI=1S/C10H10N6O2/c11-3-5-1-7-8(18-4-17-7)2-6(5)15-10(14)16-9(12)13/h1-2H,4H2,(H6,12,13,14,15,16) |
| InChIKey | JIAYFXSQSOAPRE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|