C15H10N2O3 — CID 175888730
N-(6-cyano-1,3-benzodioxol-5-yl)benzamide (PubChem CID 175888730) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is N-(6-cyano-1,3-benzodioxol-5-yl)benzamide.
| Compound Name | N-(6-cyano-1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 175888730 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-(6-cyano-1,3-benzodioxol-5-yl)benzamide |
| SMILES | N#Cc1cc2c(cc1NC(=O)c1ccccc1)OCO2 |
| InChI | InChI=1S/C15H10N2O3/c16-8-11-6-13-14(20-9-19-13)7-12(11)17-15(18)10-4-2-1-3-5-10/h1-7H,9H2,(H,17,18) |
| InChIKey | CUNJHNOFBNCNIV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |