C15H11NO4 — CID 175888729
N-(4-formyl-1,3-benzodioxol-5-yl)benzamide (PubChem CID 175888729) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is N-(4-formyl-1,3-benzodioxol-5-yl)benzamide.
| Compound Name | N-(4-formyl-1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 175888729 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-(4-formyl-1,3-benzodioxol-5-yl)benzamide |
| SMILES | O=Cc1c(NC(=O)c2ccccc2)ccc2c1OCO2 |
| InChI | InChI=1S/C15H11NO4/c17-8-11-12(6-7-13-14(11)20-9-19-13)16-15(18)10-4-2-1-3-5-10/h1-8H,9H2,(H,16,18) |
| InChIKey | UXHRKWVQAPWNOL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|