C15H8BrFN2O3 — CID 146464697
6-bromo-N-(3-cyano-2-fluorophenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 146464697) has the molecular formula C15H8BrFN2O3 and a molecular weight of 363.14 g/mol. Its IUPAC name is 6-bromo-N-(3-cyano-2-fluorophenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-bromo-N-(3-cyano-2-fluorophenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 146464697 |
| Molecular Formula | C15H8BrFN2O3 |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 6-bromo-N-(3-cyano-2-fluorophenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2cc3c(cc2Br)OCO3)c1F |
| InChI | InChI=1S/C15H8BrFN2O3/c16-10-5-13-12(21-7-22-13)4-9(10)15(20)19-11-3-1-2-8(6-18)14(11)17/h1-5H,7H2,(H,19,20) |
| InChIKey | YQNJTQYRJVVACO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |