C14H10F2N2O3 — CID 103542895
6-amino-N-(2,3-difluorophenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103542895) has the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. Its IUPAC name is 6-amino-N-(2,3-difluorophenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(2,3-difluorophenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103542895 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-amino-N-(2,3-difluorophenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Nc1cc2c(cc1C(=O)Nc1cccc(F)c1F)OCO2 |
| InChI | InChI=1S/C14H10F2N2O3/c15-8-2-1-3-10(13(8)16)18-14(19)7-4-11-12(5-9(7)17)21-6-20-11/h1-5H,6,17H2,(H,18,19) |
| InChIKey | GPKSFDKZMCPFBK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|