C14H10ClIN2O3 — CID 107624179
6-amino-N-(4-chloro-2-iodophenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 107624179) has the molecular formula C14H10ClIN2O3 and a molecular weight of 416.60 g/mol. Its IUPAC name is 6-amino-N-(4-chloro-2-iodophenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(4-chloro-2-iodophenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 107624179 |
| Molecular Formula | C14H10ClIN2O3 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 6-amino-N-(4-chloro-2-iodophenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Nc1cc2c(cc1C(=O)Nc1ccc(Cl)cc1I)OCO2 |
| InChI | InChI=1S/C14H10ClIN2O3/c15-7-1-2-11(9(16)3-7)18-14(19)8-4-12-13(5-10(8)17)21-6-20-12/h1-5H,6,17H2,(H,18,19) |
| InChIKey | ADFDLXYMVGGNFX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|