C16H11ClFNO4 — CID 18089901
N-(6-acetyl-1,3-benzodioxol-5-yl)-4-chloro-2-fluorobenzamide (PubChem CID 18089901) has the molecular formula C16H11ClFNO4 and a molecular weight of 335.72 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-4-chloro-2-fluorobenzamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 18089901 |
| Molecular Formula | C16H11ClFNO4 |
| Molecular Weight | 335.72 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-chloro-2-fluorobenzamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)c1ccc(Cl)cc1F)OCO2 |
| InChI | InChI=1S/C16H11ClFNO4/c1-8(20)11-5-14-15(23-7-22-14)6-13(11)19-16(21)10-3-2-9(17)4-12(10)18/h2-6H,7H2,1H3,(H,19,21) |
| InChIKey | XNVLNVHFZADQGK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |