C12H12ClNO4 — CID 40558372
(2S)-N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide (PubChem CID 40558372) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is (2S)-N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide.
| Compound Name | (2S)-N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide |
|---|---|
| PubChem CID | 40558372 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (2S)-N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)[C@H](C)Cl)OCO2 |
| InChI | InChI=1S/C12H12ClNO4/c1-6(13)12(16)14-9-4-11-10(17-5-18-11)3-8(9)7(2)15/h3-4,6H,5H2,1-2H3,(H,14,16)/t6-/m0/s1 |
| InChIKey | CJSBXSOARSEWRK-LURJTMIESA-N |
| XLogP | 2.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|