C16H11F2NO4 — CID 18076884
N-(6-acetyl-1,3-benzodioxol-5-yl)-3,5-difluorobenzamide (PubChem CID 18076884) has the molecular formula C16H11F2NO4 and a molecular weight of 319.26 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-3,5-difluorobenzamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 18076884 |
| Molecular Formula | C16H11F2NO4 |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3,5-difluorobenzamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)c1cc(F)cc(F)c1)OCO2 |
| InChI | InChI=1S/C16H11F2NO4/c1-8(20)12-5-14-15(23-7-22-14)6-13(12)19-16(21)9-2-10(17)4-11(18)3-9/h2-6H,7H2,1H3,(H,19,21) |
| InChIKey | NYRGNEPEJCRXRS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |