C17H12F3NO5 — CID 10338943
N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(trifluoromethoxy)benzamide (PubChem CID 10338943) has the molecular formula C17H12F3NO5 and a molecular weight of 367.28 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(trifluoromethoxy)benzamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 10338943 |
| Molecular Formula | C17H12F3NO5 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(trifluoromethoxy)benzamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)c1cccc(OC(F)(F)F)c1)OCO2 |
| InChI | InChI=1S/C17H12F3NO5/c1-9(22)12-6-14-15(25-8-24-14)7-13(12)21-16(23)10-3-2-4-11(5-10)26-17(18,19)20/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | BBWCCLLASACLIW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |