C15H11ClFNO5S — CID 5020246
N-(6-acetyl-1,3-benzodioxol-5-yl)-3-chloro-4-fluorobenzenesulfonamide (PubChem CID 5020246) has the molecular formula C15H11ClFNO5S and a molecular weight of 371.77 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-3-chloro-4-fluorobenzenesulfonamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3-chloro-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 5020246 |
| Molecular Formula | C15H11ClFNO5S |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3-chloro-4-fluorobenzenesulfonamide |
| SMILES | CC(=O)c1cc2c(cc1NS(=O)(=O)c1ccc(F)c(Cl)c1)OCO2 |
| InChI | InChI=1S/C15H11ClFNO5S/c1-8(19)10-5-14-15(23-7-22-14)6-13(10)18-24(20,21)9-2-3-12(17)11(16)4-9/h2-6,18H,7H2,1H3 |
| InChIKey | YUXCMRGLJRXVRX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |